C13H14O4 — CID 3420168
dimethyl tricyclo[4.2.1.02,5]nona-3,7-diene-3,4-dicarboxylate (PubChem CID 3420168) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is dimethyl tricyclo[4.2.1.02,5]nona-3,7-diene-3,4-dicarboxylate.
| Compound Name | dimethyl tricyclo[4.2.1.02,5]nona-3,7-diene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 3420168 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | dimethyl tricyclo[4.2.1.02,5]nona-3,7-diene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C13H14O4/c1-16-12(14)10-8-6-3-4-7(5-6)9(8)11(10)13(15)17-2/h3-4,6-9H,5H2,1-2H3 |
| InChIKey | KGTYJEHMSCHIIN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|