C26H23N3O3 — CID 3421130
2-cyano-3-(4-morpholin-4-ylphenyl)-N-(2-phenoxyphenyl)prop-2-enamide (PubChem CID 3421130) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-cyano-3-(4-morpholin-4-ylphenyl)-N-(2-phenoxyphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-(4-morpholin-4-ylphenyl)-N-(2-phenoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3421130 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 2-cyano-3-(4-morpholin-4-ylphenyl)-N-(2-phenoxyphenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(N2CCOCC2)cc1)C(=O)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C26H23N3O3/c27-19-21(18-20-10-12-22(13-11-20)29-14-16-31-17-15-29)26(30)28-24-8-4-5-9-25(24)32-23-6-2-1-3-7-23/h1-13,18H,14-17H2,(H,28,30) |
| InChIKey | XZFZPZYTQMDUSQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|