About 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile
3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile (PubChem CID 3421236) has the molecular formula C24H15Cl2N3O
and a molecular weight of 432.31 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile |
| PubChem CID | 3421236 |
| Molecular Formula | C24H15Cl2N3O |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile |
| SMILES | N#Cc1c(-c2c(Cl)cccc2Cl)noc1C=CNc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H15Cl2N3O/c25-19-10-6-11-20(26)23(19)24-18(15-27)22(30-29-24)13-14-28-21-12-5-4-9-17(21)16-7-2-1-3-8-16/h1-14,28H |
| InChIKey | FVARQXMNMCDWDV-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile?
The IUPAC name of 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile (CID 3421236) is 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile.
What is the SMILES notation for 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile?
The canonical SMILES for 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile is N#Cc1c(-c2c(Cl)cccc2Cl)noc1C=CNc1ccccc1-c1ccccc1.
What is the InChIKey of 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile?
The InChIKey is FVARQXMNMCDWDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15Cl2N3O/c25-19-10-6-11-20(26)23(19)24-18(15-27)22(30-29-24)13-14-28-21-12-5-4-9-17(21)16-7-2-1-3-8-16/h1-14,28H.
What are the key properties of 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile?
3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile has a molecular weight of 432.31 g/mol, XLogP of 7.27, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dichlorophenyl)-5-[2-(2-phenylanilino)ethenyl]-1,2-oxazole-4-carbonitrile is sourced from PubChem (CID 3421236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).