C47H38N4O7 — CID 3421298
2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(4-hydroxy-2-methoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3421298) has the molecular formula C47H38N4O7 and a molecular weight of 770.84 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(4-hydroxy-2-methoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(4-hydroxy-2-methoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3421298 |
| Molecular Formula | C47H38N4O7 |
| Molecular Weight | 770.84 g/mol |
| Exact Mass | 770.27 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(4-hydroxy-2-methoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)ccc1C1C2=CCC3C(=O)N(c4ccc(-c5nc6ccccc6o5)cc4)C(=O)C3C2CC2C(=O)N(Nc3ccc(C)cc3)C(=O)C21c1ccccc1 |
| InChI | InChI=1S/C47H38N4O7/c1-26-12-16-29(17-13-26)49-51-44(54)36-25-35-32(41(33-21-20-31(52)24-39(33)57-2)47(36,46(51)56)28-8-4-3-5-9-28)22-23-34-40(35)45(55)50(43(34)53)30-18-14-27(15-19-30)42-48-37-10-6-7-11-38(37)58-42/h3-22,24,34-36,40-41,49,52H,23,25H2,1-2H3 |
| InChIKey | BNCUNEATGBMJBG-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.84 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|