C23H23BrN2O2 — CID 34215979
4-[[(2-bromophenyl)methyl-(furan-2-ylmethyl)amino]methyl]-N-cyclopropylbenzamide (PubChem CID 34215979) has the molecular formula C23H23BrN2O2 and a molecular weight of 439.35 g/mol. Its IUPAC name is 4-[[(2-bromophenyl)methyl-(furan-2-ylmethyl)amino]methyl]-N-cyclopropylbenzamide.
| Compound Name | 4-[[(2-bromophenyl)methyl-(furan-2-ylmethyl)amino]methyl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 34215979 |
| Molecular Formula | C23H23BrN2O2 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 4-[[(2-bromophenyl)methyl-(furan-2-ylmethyl)amino]methyl]-N-cyclopropylbenzamide |
| SMILES | O=C(NC1CC1)c1ccc(CN(Cc2ccco2)Cc2ccccc2Br)cc1 |
| InChI | InChI=1S/C23H23BrN2O2/c24-22-6-2-1-4-19(22)15-26(16-21-5-3-13-28-21)14-17-7-9-18(10-8-17)23(27)25-20-11-12-20/h1-10,13,20H,11-12,14-16H2,(H,25,27) |
| InChIKey | GAYDIZDBJJRGMA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |