C18H12N2O4 — CID 3421828
4-benzylidene-2-[2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-one (PubChem CID 3421828) has the molecular formula C18H12N2O4 and a molecular weight of 320.30 g/mol. Its IUPAC name is 4-benzylidene-2-[2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-one.
| Compound Name | 4-benzylidene-2-[2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3421828 |
| Molecular Formula | C18H12N2O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-benzylidene-2-[2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-one |
| SMILES | O=C1OC(C=Cc2cccc([N+](=O)[O-])c2)=NC1=Cc1ccccc1 |
| InChI | InChI=1S/C18H12N2O4/c21-18-16(12-13-5-2-1-3-6-13)19-17(24-18)10-9-14-7-4-8-15(11-14)20(22)23/h1-12H |
| InChIKey | MQXMBODJJKNZTP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|