C18H21FN2O2 — CID 34218990
2-[cyclopropyl(furan-2-ylmethyl)amino]-N-[(4-fluoro-3-methylphenyl)methyl]acetamide (PubChem CID 34218990) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-[cyclopropyl(furan-2-ylmethyl)amino]-N-[(4-fluoro-3-methylphenyl)methyl]acetamide.
| Compound Name | 2-[cyclopropyl(furan-2-ylmethyl)amino]-N-[(4-fluoro-3-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 34218990 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-[cyclopropyl(furan-2-ylmethyl)amino]-N-[(4-fluoro-3-methylphenyl)methyl]acetamide |
| SMILES | Cc1cc(CNC(=O)CN(Cc2ccco2)C2CC2)ccc1F |
| InChI | InChI=1S/C18H21FN2O2/c1-13-9-14(4-7-17(13)19)10-20-18(22)12-21(15-5-6-15)11-16-3-2-8-23-16/h2-4,7-9,15H,5-6,10-12H2,1H3,(H,20,22) |
| InChIKey | LZWMKOXPDFYJPA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |