About 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one
1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one (PubChem CID 34227639) has the molecular formula C7H10N6O2S
and a molecular weight of 242.26 g/mol. Its IUPAC name is 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one |
| PubChem CID | 34227639 |
| Molecular Formula | C7H10N6O2S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one |
| SMILES | Nc1nc(SCC(=O)N2CCNC2=O)n[nH]1 |
| InChI | InChI=1S/C7H10N6O2S/c8-5-10-6(12-11-5)16-3-4(14)13-2-1-9-7(13)15/h1-3H2,(H,9,15)(H3,8,10,11,12) |
| InChIKey | AQXXFGCJXJZPPQ-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one?
The IUPAC name of 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one (CID 34227639) is 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one.
What is the SMILES notation for 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one?
The canonical SMILES for 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one is Nc1nc(SCC(=O)N2CCNC2=O)n[nH]1.
What is the InChIKey of 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one?
The InChIKey is AQXXFGCJXJZPPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6O2S/c8-5-10-6(12-11-5)16-3-4(14)13-2-1-9-7(13)15/h1-3H2,(H,9,15)(H3,8,10,11,12).
What are the key properties of 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one?
1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one has a molecular weight of 242.26 g/mol, XLogP of -0.97, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]imidazolidin-2-one is sourced from PubChem (CID 34227639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).