About 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione
8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione (PubChem CID 3422836) has the molecular formula C16H14N2OS
and a molecular weight of 282.37 g/mol. Its IUPAC name is 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione.
Molecular Properties
| Compound Name | 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione |
| PubChem CID | 3422836 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione |
| SMILES | COc1ccc2c(c1)NC(=S)CC(c1ccccc1)=N2 |
| InChI | InChI=1S/C16H14N2OS/c1-19-12-7-8-13-15(9-12)18-16(20)10-14(17-13)11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,18,20) |
| InChIKey | GEJQQZQAKCMMFY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione?
The IUPAC name of 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione (CID 3422836) is 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione.
What is the SMILES notation for 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione?
The canonical SMILES for 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione is COc1ccc2c(c1)NC(=S)CC(c1ccccc1)=N2.
What is the InChIKey of 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione?
The InChIKey is GEJQQZQAKCMMFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2OS/c1-19-12-7-8-13-15(9-12)18-16(20)10-14(17-13)11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,18,20).
What are the key properties of 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione?
8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione has a molecular weight of 282.37 g/mol, XLogP of 3.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepine-2-thione is sourced from PubChem (CID 3422836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).