C20H20BrN3O2S — CID 3423214
10-(3-bromophenyl)-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide (PubChem CID 3423214) has the molecular formula C20H20BrN3O2S and a molecular weight of 446.37 g/mol. Its IUPAC name is 10-(3-bromophenyl)-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide.
| Compound Name | 10-(3-bromophenyl)-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide |
|---|---|
| PubChem CID | 3423214 |
| Molecular Formula | C20H20BrN3O2S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 10-(3-bromophenyl)-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide |
| SMILES | CN(C)C(=O)C1C2NC(=S)N(c3cccc(Br)c3)C1(C)Oc1ccccc12 |
| InChI | InChI=1S/C20H20BrN3O2S/c1-20-16(18(25)23(2)3)17(14-9-4-5-10-15(14)26-20)22-19(27)24(20)13-8-6-7-12(21)11-13/h4-11,16-17H,1-3H3,(H,22,27) |
| InChIKey | MJXXVFXIZQWGRX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|