C25H25N3O4 — CID 34239440
N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanamide (PubChem CID 34239440) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanamide.
| Compound Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanamide |
|---|---|
| PubChem CID | 34239440 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-[2-(4-methoxyphenyl)-1H-indol-3-yl]propanamide |
| SMILES | COc1ccc(-c2[nH]c3ccccc3c2CCC(=O)NCC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C25H25N3O4/c1-31-18-10-8-17(9-11-18)25-21(20-6-2-3-7-22(20)28-25)12-13-23(29)27-16-24(30)26-15-19-5-4-14-32-19/h2-11,14,28H,12-13,15-16H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | JNFADXWGOPGIKU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |