C7H10N2O4 — CID 3424069
1-(2,3-dihydroxypropyl)pyrimidine-2,4-dione (PubChem CID 3424069) has the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)pyrimidine-2,4-dione.
| Compound Name | 1-(2,3-dihydroxypropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3424069 |
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CC(O)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C7H10N2O4/c10-4-5(11)3-9-2-1-6(12)8-7(9)13/h1-2,5,10-11H,3-4H2,(H,8,12,13) |
| InChIKey | UPONUIQDSKBZHK-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |