C10H15ClN4O — CID 3424209
4-chloro-N,N-dimethyl-6-morpholin-4-ylpyrimidin-2-amine (PubChem CID 3424209) has the molecular formula C10H15ClN4O and a molecular weight of 242.71 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-6-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | 4-chloro-N,N-dimethyl-6-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 3424209 |
| Molecular Formula | C10H15ClN4O |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-chloro-N,N-dimethyl-6-morpholin-4-ylpyrimidin-2-amine |
| SMILES | CN(C)c1nc(Cl)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C10H15ClN4O/c1-14(2)10-12-8(11)7-9(13-10)15-3-5-16-6-4-15/h7H,3-6H2,1-2H3 |
| InChIKey | RXXUOUWOIFWJST-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |