C15H15N3O3S — CID 34244779
1-(12,12-dimethyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)pyrrolidine-2,5-dione (PubChem CID 34244779) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 1-(12,12-dimethyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(12,12-dimethyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 34244779 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(12,12-dimethyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)pyrrolidine-2,5-dione |
| SMILES | CC1(C)Cc2c(sc3ncnc(N4C(=O)CCC4=O)c23)CO1 |
| InChI | InChI=1S/C15H15N3O3S/c1-15(2)5-8-9(6-21-15)22-14-12(8)13(16-7-17-14)18-10(19)3-4-11(18)20/h7H,3-6H2,1-2H3 |
| InChIKey | RBCAITUPLUQPKS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|