C17H22N4O2 — CID 34248936
N-cyclohexyl-N-methyl-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide (PubChem CID 34248936) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide.
| Compound Name | N-cyclohexyl-N-methyl-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide |
|---|---|
| PubChem CID | 34248936 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-cyclohexyl-N-methyl-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide |
| SMILES | CN(C(=O)CCn1nnc2ccccc2c1=O)C1CCCCC1 |
| InChI | InChI=1S/C17H22N4O2/c1-20(13-7-3-2-4-8-13)16(22)11-12-21-17(23)14-9-5-6-10-15(14)18-19-21/h5-6,9-10,13H,2-4,7-8,11-12H2,1H3 |
| InChIKey | FDDAXRDQPXEWNG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |