C16H14N6OS — CID 34249854
N-(1,3-benzothiazol-2-yl)-N,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 34249854) has the molecular formula C16H14N6OS and a molecular weight of 338.40 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 34249854 |
| Molecular Formula | C16H14N6OS |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C)n2nc(C(=O)N(C)c3nc4ccccc4s3)nc2n1 |
| InChI | InChI=1S/C16H14N6OS/c1-9-8-10(2)22-15(17-9)19-13(20-22)14(23)21(3)16-18-11-6-4-5-7-12(11)24-16/h4-8H,1-3H3 |
| InChIKey | HWQFHEOHWRGNMM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 76.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |