C26H26N3O3+ — CID 3425106
9-(3,4-dimethoxyphenyl)-6-pyridin-1-ium-4-yl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 3425106) has the molecular formula C26H26N3O3+ and a molecular weight of 428.51 g/mol. Its IUPAC name is 9-(3,4-dimethoxyphenyl)-6-pyridin-1-ium-4-yl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-(3,4-dimethoxyphenyl)-6-pyridin-1-ium-4-yl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 3425106 |
| Molecular Formula | C26H26N3O3+ |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 9-(3,4-dimethoxyphenyl)-6-pyridin-1-ium-4-yl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1ccc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2cc[nH+]cc2)cc1OC |
| InChI | InChI=1S/C26H25N3O3/c1-31-23-8-7-17(15-24(23)32-2)18-13-21-25(22(30)14-18)26(16-9-11-27-12-10-16)29-20-6-4-3-5-19(20)28-21/h3-12,15,18,26,28-29H,13-14H2,1-2H3/p+1 |
| InChIKey | YSPATPBMNCXEOI-UHFFFAOYSA-O |
| XLogP | 4.50 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |