About [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate
[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate (PubChem CID 34253053) has the molecular formula C9H15N5OS2
and a molecular weight of 273.39 g/mol. Its IUPAC name is [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate |
| PubChem CID | 34253053 |
| Molecular Formula | C9H15N5OS2 |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate |
| SMILES | COc1nc(SC(=S)N(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C9H15N5OS2/c1-13(2)6-10-7(15-5)12-8(11-6)17-9(16)14(3)4/h1-5H3 |
| InChIKey | BFBPQVWRFVDJSJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate?
The IUPAC name of [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate (CID 34253053) is [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate.
What is the SMILES notation for [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate?
The canonical SMILES for [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate is COc1nc(SC(=S)N(C)C)nc(N(C)C)n1.
What is the InChIKey of [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate?
The InChIKey is BFBPQVWRFVDJSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5OS2/c1-13(2)6-10-7(15-5)12-8(11-6)17-9(16)14(3)4/h1-5H3.
What are the key properties of [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate?
[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate has a molecular weight of 273.39 g/mol, XLogP of 0.88, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl] N,N-dimethylcarbamodithioate is sourced from PubChem (CID 34253053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).