About N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide
N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide (PubChem CID 3425381) has the molecular formula C10H12N4O2S2
and a molecular weight of 284.37 g/mol. Its IUPAC name is N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide |
| PubChem CID | 3425381 |
| Molecular Formula | C10H12N4O2S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1nc(SCc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C10H12N4O2S2/c1-18(15,16)14-9-11-10(13-12-9)17-7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H2,11,12,13,14) |
| InChIKey | MXHXVQAHEJGHSW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide?
The IUPAC name of N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide (CID 3425381) is N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide.
What is the SMILES notation for N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide?
The canonical SMILES for N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide is CS(=O)(=O)Nc1nc(SCc2ccccc2)n[nH]1.
What is the InChIKey of N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide?
The InChIKey is MXHXVQAHEJGHSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O2S2/c1-18(15,16)14-9-11-10(13-12-9)17-7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H2,11,12,13,14).
What are the key properties of N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide?
N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide has a molecular weight of 284.37 g/mol, XLogP of 1.47, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-benzylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide is sourced from PubChem (CID 3425381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).