C16H15ClN2O3 — CID 34259420
methyl N-[(1S)-1-(2-chloroanilino)-2-oxo-2-phenylethyl]carbamate (PubChem CID 34259420) has the molecular formula C16H15ClN2O3 and a molecular weight of 318.76 g/mol. Its IUPAC name is methyl N-[(1S)-1-(2-chloroanilino)-2-oxo-2-phenylethyl]carbamate.
| Compound Name | methyl N-[(1S)-1-(2-chloroanilino)-2-oxo-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 34259420 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | methyl N-[(1S)-1-(2-chloroanilino)-2-oxo-2-phenylethyl]carbamate |
| SMILES | COC(=O)N[C@H](Nc1ccccc1Cl)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H15ClN2O3/c1-22-16(21)19-15(14(20)11-7-3-2-4-8-11)18-13-10-6-5-9-12(13)17/h2-10,15,18H,1H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | AIXANSLGJSNSMH-HNNXBMFYSA-N |
| XLogP | 3.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|