About 2-(hydroxymethyl)oxane-2,3,4,5-tetrol
2-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 3426) has the molecular formula C6H12O6
and a molecular weight of 180.16 g/mol. Its IUPAC name is 2-(hydroxymethyl)oxane-2,3,4,5-tetrol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| PubChem CID | 3426 |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OCC1(O)OCC(O)C(O)C1O |
| InChI | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2 |
| InChIKey | LKDRXBCSQODPBY-UHFFFAOYSA-N |
| XLogP | -3.22 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(hydroxymethyl)oxane-2,3,4,5-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)oxane-2,3,4,5-tetrol?
The IUPAC name of 2-(hydroxymethyl)oxane-2,3,4,5-tetrol (CID 3426) is 2-(hydroxymethyl)oxane-2,3,4,5-tetrol.
What is the SMILES notation for 2-(hydroxymethyl)oxane-2,3,4,5-tetrol?
The canonical SMILES for 2-(hydroxymethyl)oxane-2,3,4,5-tetrol is OCC1(O)OCC(O)C(O)C1O.
What is the InChIKey of 2-(hydroxymethyl)oxane-2,3,4,5-tetrol?
The InChIKey is LKDRXBCSQODPBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2.
What are the key properties of 2-(hydroxymethyl)oxane-2,3,4,5-tetrol?
2-(hydroxymethyl)oxane-2,3,4,5-tetrol has a molecular weight of 180.16 g/mol, XLogP of -3.22, 1 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)oxane-2,3,4,5-tetrol is sourced from PubChem (CID 3426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).