C21H15Cl3F3N7O4 — CID 3427216
5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-[1-(2,4-dichlorophenyl)-3-methyl-5-oxo-1,2,4-triazolidin-3-yl]-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 3427216) has the molecular formula C21H15Cl3F3N7O4 and a molecular weight of 592.75 g/mol. Its IUPAC name is 5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-[1-(2,4-dichlorophenyl)-3-methyl-5-oxo-1,2,4-triazolidin-3-yl]-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-[1-(2,4-dichlorophenyl)-3-methyl-5-oxo-1,2,4-triazolidin-3-yl]-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 3427216 |
| Molecular Formula | C21H15Cl3F3N7O4 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 591.02 |
| IUPAC Name | 5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-[1-(2,4-dichlorophenyl)-3-methyl-5-oxo-1,2,4-triazolidin-3-yl]-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CN(c1ncc(C(F)(F)F)cc1Cl)N1C(=O)C2ON=C(C3(C)NC(=O)N(c4ccc(Cl)cc4Cl)N3)C2C1=O |
| InChI | InChI=1S/C21H15Cl3F3N7O4/c1-20(29-19(37)33(31-20)12-4-3-9(22)6-10(12)23)15-13-14(38-30-15)18(36)34(17(13)35)32(2)16-11(24)5-8(7-28-16)21(25,26)27/h3-7,13-14,31H,1-2H3,(H,29,37) |
| InChIKey | UOIZHPBMVCRLQB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|