C21H23F17N2O2 — CID 3427397
N,N-dicyclohexyl-2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanimidamide (PubChem CID 3427397) has the molecular formula C21H23F17N2O2 and a molecular weight of 658.39 g/mol. Its IUPAC name is N,N-dicyclohexyl-2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanimidamide.
| Compound Name | N,N-dicyclohexyl-2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanimidamide |
|---|---|
| PubChem CID | 3427397 |
| Molecular Formula | C21H23F17N2O2 |
| Molecular Weight | 658.39 g/mol |
| Exact Mass | 658.15 |
| IUPAC Name | N,N-dicyclohexyl-2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanimidamide |
| SMILES | [H]/N=C(\N(C1CCCCC1)C1CCCCC1)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H23F17N2O2/c22-14(17(26,27)28,13(39)40(11-7-3-1-4-8-11)12-9-5-2-6-10-12)41-21(37,38)16(25,19(32,33)34)42-20(35,36)15(23,24)18(29,30)31/h11-12,39H,1-10H2/b39-13- |
| InChIKey | FRSCKBDQARRRNS-FCIITPAPSA-N |
| XLogP | 8.80 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.39 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|