C28H33N3O6 — CID 3427926
2-(4-butoxy-3-ethoxyphenyl)-4-hydroxy-1-(3-imidazol-1-ylpropyl)-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3427926) has the molecular formula C28H33N3O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is 2-(4-butoxy-3-ethoxyphenyl)-4-hydroxy-1-(3-imidazol-1-ylpropyl)-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxy-3-ethoxyphenyl)-4-hydroxy-1-(3-imidazol-1-ylpropyl)-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3427926 |
| Molecular Formula | C28H33N3O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 2-(4-butoxy-3-ethoxyphenyl)-4-hydroxy-1-(3-imidazol-1-ylpropyl)-3-(5-methylfuran-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3ccc(C)o3)=C(O)C(=O)N2CCCn2ccnc2)cc1OCC |
| InChI | InChI=1S/C28H33N3O6/c1-4-6-16-36-21-11-9-20(17-23(21)35-5-2)25-24(26(32)22-10-8-19(3)37-22)27(33)28(34)31(25)14-7-13-30-15-12-29-18-30/h8-12,15,17-18,25,33H,4-7,13-14,16H2,1-3H3 |
| InChIKey | TYYWCNZCYAXFPX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|