C17H18NO3- — CID 3428348
2-[3-(cyclohexanecarbonyl)indol-1-yl]acetate (PubChem CID 3428348) has the molecular formula C17H18NO3- and a molecular weight of 284.33 g/mol. Its IUPAC name is 2-[3-(cyclohexanecarbonyl)indol-1-yl]acetate.
| Compound Name | 2-[3-(cyclohexanecarbonyl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 3428348 |
| Molecular Formula | C17H18NO3- |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[3-(cyclohexanecarbonyl)indol-1-yl]acetate |
| SMILES | O=C([O-])Cn1cc(C(=O)C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C17H19NO3/c19-16(20)11-18-10-14(13-8-4-5-9-15(13)18)17(21)12-6-2-1-3-7-12/h4-5,8-10,12H,1-3,6-7,11H2,(H,19,20)/p-1 |
| InChIKey | AJWJGLLQTPRJBZ-UHFFFAOYSA-M |
| XLogP | 2.15 |
| TPSA | 62.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |