C21H24Cl2N2O3S — CID 3428690
N-(2,6-dichlorophenyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 3428690) has the molecular formula C21H24Cl2N2O3S and a molecular weight of 455.41 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3428690 |
| Molecular Formula | C21H24Cl2N2O3S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-(2,6-dichlorophenyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCCC(C(=O)Nc3c(Cl)cccc3Cl)C2)c(C)c1 |
| InChI | InChI=1S/C21H24Cl2N2O3S/c1-13-10-14(2)20(15(3)11-13)29(27,28)25-9-5-6-16(12-25)21(26)24-19-17(22)7-4-8-18(19)23/h4,7-8,10-11,16H,5-6,9,12H2,1-3H3,(H,24,26) |
| InChIKey | HKTJUHZFHQOWJF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |