C6H14O5 — CID 3429
hexane-1,2,3,4,5-pentol (PubChem CID 3429) has the molecular formula C6H14O5 and a molecular weight of 166.17 g/mol. Its IUPAC name is hexane-1,2,3,4,5-pentol.
| Compound Name | hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 3429 |
| Molecular Formula | C6H14O5 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | hexane-1,2,3,4,5-pentol |
| SMILES | CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H14O5/c1-3(8)5(10)6(11)4(9)2-7/h3-11H,2H2,1H3 |
| InChIKey | SKCKOFZKJLZSFA-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |