C17H14ClFN6O2 — CID 3429791
2-N-[(4-chlorophenyl)methyl]-4-N-(4-fluorophenyl)-5-nitropyrimidine-2,4,6-triamine (PubChem CID 3429791) has the molecular formula C17H14ClFN6O2 and a molecular weight of 388.79 g/mol. Its IUPAC name is 2-N-[(4-chlorophenyl)methyl]-4-N-(4-fluorophenyl)-5-nitropyrimidine-2,4,6-triamine.
| Compound Name | 2-N-[(4-chlorophenyl)methyl]-4-N-(4-fluorophenyl)-5-nitropyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 3429791 |
| Molecular Formula | C17H14ClFN6O2 |
| Molecular Weight | 388.79 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-N-[(4-chlorophenyl)methyl]-4-N-(4-fluorophenyl)-5-nitropyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(NCc2ccc(Cl)cc2)nc(Nc2ccc(F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClFN6O2/c18-11-3-1-10(2-4-11)9-21-17-23-15(20)14(25(26)27)16(24-17)22-13-7-5-12(19)6-8-13/h1-8H,9H2,(H4,20,21,22,23,24) |
| InChIKey | DDHDDLPGODILFW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|