About 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate
2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate (PubChem CID 3430762) has the molecular formula C10H13Cl3N4O5
and a molecular weight of 375.60 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate.
Molecular Properties
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate |
| PubChem CID | 3430762 |
| Molecular Formula | C10H13Cl3N4O5 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate |
| SMILES | COC(NC(=O)OCCn1c([N+](=O)[O-])cnc1C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H13Cl3N4O5/c1-6-14-5-7(17(19)20)16(6)3-4-22-9(18)15-8(21-2)10(11,12)13/h5,8H,3-4H2,1-2H3,(H,15,18) |
| InChIKey | DBTPCSVSLJRQDP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate?
The IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate (CID 3430762) is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate.
What is the SMILES notation for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate?
The canonical SMILES for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate is COC(NC(=O)OCCn1c([N+](=O)[O-])cnc1C)C(Cl)(Cl)Cl.
What is the InChIKey of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate?
The InChIKey is DBTPCSVSLJRQDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl3N4O5/c1-6-14-5-7(17(19)20)16(6)3-4-22-9(18)15-8(21-2)10(11,12)13/h5,8H,3-4H2,1-2H3,(H,15,18).
What are the key properties of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate?
2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate has a molecular weight of 375.60 g/mol, XLogP of 2.17, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(2,2,2-trichloro-1-methoxyethyl)carbamate is sourced from PubChem (CID 3430762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).