About 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one
3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one (PubChem CID 3430818) has the molecular formula C23H21NO4S
and a molecular weight of 407.49 g/mol. Its IUPAC name is 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one.
Molecular Properties
| Compound Name | 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one |
| PubChem CID | 3430818 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one |
| SMILES | CCCCOc1ccc(-c2csc(-c3cc4cccc(OC)c4oc3=O)n2)cc1 |
| InChI | InChI=1S/C23H21NO4S/c1-3-4-12-27-17-10-8-15(9-11-17)19-14-29-22(24-19)18-13-16-6-5-7-20(26-2)21(16)28-23(18)25/h5-11,13-14H,3-4,12H2,1-2H3 |
| InChIKey | JBKCCYIYHYDDOI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one?
The IUPAC name of 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one (CID 3430818) is 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one.
What is the SMILES notation for 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one?
The canonical SMILES for 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one is CCCCOc1ccc(-c2csc(-c3cc4cccc(OC)c4oc3=O)n2)cc1.
What is the InChIKey of 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one?
The InChIKey is JBKCCYIYHYDDOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO4S/c1-3-4-12-27-17-10-8-15(9-11-17)19-14-29-22(24-19)18-13-16-6-5-7-20(26-2)21(16)28-23(18)25/h5-11,13-14H,3-4,12H2,1-2H3.
What are the key properties of 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one?
3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one has a molecular weight of 407.49 g/mol, XLogP of 5.77, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-8-methoxychromen-2-one is sourced from PubChem (CID 3430818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).