C18H20N4OS2 — CID 3430876
4-(5,5-dimethyl-6,17-dithia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaen-15-yl)morpholine (PubChem CID 3430876) has the molecular formula C18H20N4OS2 and a molecular weight of 372.52 g/mol. Its IUPAC name is 4-(5,5-dimethyl-6,17-dithia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaen-15-yl)morpholine.
| Compound Name | 4-(5,5-dimethyl-6,17-dithia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaen-15-yl)morpholine |
|---|---|
| PubChem CID | 3430876 |
| Molecular Formula | C18H20N4OS2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4-(5,5-dimethyl-6,17-dithia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaen-15-yl)morpholine |
| SMILES | CC1(C)Cc2nc3sc4c(N5CCOCC5)ncnc4c3cc2CS1 |
| InChI | InChI=1S/C18H20N4OS2/c1-18(2)8-13-11(9-24-18)7-12-14-15(25-17(12)21-13)16(20-10-19-14)22-3-5-23-6-4-22/h7,10H,3-6,8-9H2,1-2H3 |
| InChIKey | MCGDOEDIUUKKRH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |