About N-((Phenylmethoxy)carbonyl)-L-phenylalanine ethyl ester
N-((Phenylmethoxy)carbonyl)-L-phenylalanine ethyl ester (PubChem CID 34309) has the molecular formula C19H21NO4
and a molecular weight of 327.40 g/mol. Its IUPAC name is ethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
Molecular Properties
| Compound Name | N-((Phenylmethoxy)carbonyl)-L-phenylalanine ethyl ester |
| PubChem CID | 34309 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | ethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)[C@H](CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
| InChI | InChI=1S/C19H21NO4/c1-2-23-18(21)17(13-15-9-5-3-6-10-15)20-19(22)24-14-16-11-7-4-8-12-16/h3-12,17H,2,13-14H2,1H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | XLLUIEKQXIOPDX-KRWDZBQOSA-N |
| XLogP | 3.70 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | 387 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-((Phenylmethoxy)carbonyl)-L-phenylalanine ethyl ester with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-((Phenylmethoxy)carbonyl)-L-phenylalanine ethyl ester?
The IUPAC name of N-((Phenylmethoxy)carbonyl)-L-phenylalanine ethyl ester (CID 34309) is ethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
What is the SMILES notation for N-((Phenylmethoxy)carbonyl)-L-phenylalanine ethyl ester?
The canonical SMILES for N-((Phenylmethoxy)carbonyl)-L-phenylalanine ethyl ester is CCOC(=O)[C@H](CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2.
What is the InChIKey of N-((Phenylmethoxy)carbonyl)-L-phenylalanine ethyl ester?
The InChIKey is XLLUIEKQXIOPDX-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H21NO4/c1-2-23-18(21)17(13-15-9-5-3-6-10-15)20-19(22)24-14-16-11-7-4-8-12-16/h3-12,17H,2,13-14H2,1H3,(H,20,22)/t17-/m0/s1.
What are the key properties of N-((Phenylmethoxy)carbonyl)-L-phenylalanine ethyl ester?
N-((Phenylmethoxy)carbonyl)-L-phenylalanine ethyl ester has a molecular weight of 327.40 g/mol, XLogP of 3.70, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-((Phenylmethoxy)carbonyl)-L-phenylalanine ethyl ester is sourced from PubChem (CID 34309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).