C8H6O4S — CID 3430937
2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarbaldehyde (PubChem CID 3430937) has the molecular formula C8H6O4S and a molecular weight of 198.20 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarbaldehyde.
| Compound Name | 2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarbaldehyde |
|---|---|
| PubChem CID | 3430937 |
| Molecular Formula | C8H6O4S |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarbaldehyde |
| SMILES | O=Cc1sc(C=O)c2c1OCCO2 |
| InChI | InChI=1S/C8H6O4S/c9-3-5-7-8(6(4-10)13-5)12-2-1-11-7/h3-4H,1-2H2 |
| InChIKey | OYWUVHMKKSZDJH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|