C25H17N3O4S — CID 34311526
(5Z)-2-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-5-[(3-phenoxyphenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 34311526) has the molecular formula C25H17N3O4S and a molecular weight of 455.50 g/mol. Its IUPAC name is (5Z)-2-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-5-[(3-phenoxyphenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | (5Z)-2-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-5-[(3-phenoxyphenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 34311526 |
| Molecular Formula | C25H17N3O4S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | (5Z)-2-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-5-[(3-phenoxyphenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | O=c1/c(=C/c2cccc(Oc3ccccc3)c2)sc2nc([C@@H]3COc4ccccc4O3)nn12 |
| InChI | InChI=1S/C25H17N3O4S/c29-24-22(14-16-7-6-10-18(13-16)31-17-8-2-1-3-9-17)33-25-26-23(27-28(24)25)21-15-30-19-11-4-5-12-20(19)32-21/h1-14,21H,15H2/b22-14-/t21-/m0/s1 |
| InChIKey | GGYSPNLGKHMSHQ-ODLJZMMESA-N |
| XLogP | 4.00 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |