C19H19N3O3S2 — CID 34314459
N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-4-methylbenzamide (PubChem CID 34314459) has the molecular formula C19H19N3O3S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-4-methylbenzamide.
| Compound Name | N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 34314459 |
| Molecular Formula | C19H19N3O3S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc(-c3ccc(S(=O)(=O)N(C)C)cc3)cs2)cc1 |
| InChI | InChI=1S/C19H19N3O3S2/c1-13-4-6-15(7-5-13)18(23)21-19-20-17(12-26-19)14-8-10-16(11-9-14)27(24,25)22(2)3/h4-12H,1-3H3,(H,20,21,23) |
| InChIKey | UUPIZHFWKRPNMA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |