C17H17ClFNO3S — CID 34314546
3-(4-chlorophenyl)sulfonyl-N-[(3-fluoro-4-methylphenyl)methyl]propanamide (PubChem CID 34314546) has the molecular formula C17H17ClFNO3S and a molecular weight of 369.85 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-N-[(3-fluoro-4-methylphenyl)methyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-N-[(3-fluoro-4-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 34314546 |
| Molecular Formula | C17H17ClFNO3S |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-N-[(3-fluoro-4-methylphenyl)methyl]propanamide |
| SMILES | Cc1ccc(CNC(=O)CCS(=O)(=O)c2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C17H17ClFNO3S/c1-12-2-3-13(10-16(12)19)11-20-17(21)8-9-24(22,23)15-6-4-14(18)5-7-15/h2-7,10H,8-9,11H2,1H3,(H,20,21) |
| InChIKey | WHWXMWCQUOUZRB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |