About 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea
1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea (PubChem CID 3431830) has the molecular formula C22H21ClN2O
and a molecular weight of 364.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea |
| PubChem CID | 3431830 |
| Molecular Formula | C22H21ClN2O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O/c23-19-11-13-20(14-12-19)25-22(26)24-16-15-21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,21H,15-16H2,(H2,24,25,26) |
| InChIKey | FVVUFTXFMCPUAO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea?
The IUPAC name of 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea (CID 3431830) is 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea.
What is the SMILES notation for 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea?
The canonical SMILES for 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea is O=C(NCCC(c1ccccc1)c1ccccc1)Nc1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea?
The InChIKey is FVVUFTXFMCPUAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClN2O/c23-19-11-13-20(14-12-19)25-22(26)24-16-15-21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,21H,15-16H2,(H2,24,25,26).
What are the key properties of 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea?
1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea has a molecular weight of 364.88 g/mol, XLogP of 5.68, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-3-(3,3-diphenylpropyl)urea is sourced from PubChem (CID 3431830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).