C20H11Cl2N3O3S2 — CID 34318341
(1S)-7-chloro-1-(4-chlorophenyl)-2-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 34318341) has the molecular formula C20H11Cl2N3O3S2 and a molecular weight of 476.37 g/mol. Its IUPAC name is (1S)-7-chloro-1-(4-chlorophenyl)-2-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1S)-7-chloro-1-(4-chlorophenyl)-2-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 34318341 |
| Molecular Formula | C20H11Cl2N3O3S2 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 474.96 |
| IUPAC Name | (1S)-7-chloro-1-(4-chlorophenyl)-2-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CSc1nnc(N2C(=O)c3oc4ccc(Cl)cc4c(=O)c3[C@@H]2c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C20H11Cl2N3O3S2/c1-29-20-24-23-19(30-20)25-15(9-2-4-10(21)5-3-9)14-16(26)12-8-11(22)6-7-13(12)28-17(14)18(25)27/h2-8,15H,1H3/t15-/m0/s1 |
| InChIKey | NCOLARICHOVXKL-HNNXBMFYSA-N |
| XLogP | 5.42 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|