C18H21N3O3S — CID 3431885
2-[4-(4-methoxyphenyl)-6-methylpyrimidin-2-yl]sulfanyl-1-morpholin-4-ylethanone (PubChem CID 3431885) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-6-methylpyrimidin-2-yl]sulfanyl-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-(4-methoxyphenyl)-6-methylpyrimidin-2-yl]sulfanyl-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 3431885 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-6-methylpyrimidin-2-yl]sulfanyl-1-morpholin-4-ylethanone |
| SMILES | COc1ccc(-c2cc(C)nc(SCC(=O)N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C18H21N3O3S/c1-13-11-16(14-3-5-15(23-2)6-4-14)20-18(19-13)25-12-17(22)21-7-9-24-10-8-21/h3-6,11H,7-10,12H2,1-2H3 |
| InChIKey | CPVIWWAFPGIDDP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |