C22H21F2N2O+ — CID 34319491
1-(4-fluorophenyl)-2-[3-(4-fluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]ethanone (PubChem CID 34319491) has the molecular formula C22H21F2N2O+ and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[3-(4-fluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]ethanone.
| Compound Name | 1-(4-fluorophenyl)-2-[3-(4-fluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 34319491 |
| Molecular Formula | C22H21F2N2O+ |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[3-(4-fluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]ethanone |
| SMILES | O=C(C[n+]1cc(-c2ccc(F)cc2)n2c1CCCCC2)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21F2N2O/c23-18-9-5-16(6-10-18)20-14-25(22-4-2-1-3-13-26(20)22)15-21(27)17-7-11-19(24)12-8-17/h5-12,14H,1-4,13,15H2/q+1 |
| InChIKey | QGXSAKXHVBSNJJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|