About 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide
4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide (PubChem CID 3432012) has the molecular formula C12H13N3OS2
and a molecular weight of 279.39 g/mol. Its IUPAC name is 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
| PubChem CID | 3432012 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ccc(-n2c(N)c(C(N)=O)sc2=S)cc1C |
| InChI | InChI=1S/C12H13N3OS2/c1-6-3-4-8(5-7(6)2)15-10(13)9(11(14)16)18-12(15)17/h3-5H,13H2,1-2H3,(H2,14,16) |
| InChIKey | WOBSQBNSRUKBRB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide (CID 3432012) is 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide is Cc1ccc(-n2c(N)c(C(N)=O)sc2=S)cc1C.
What is the InChIKey of 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide?
The InChIKey is WOBSQBNSRUKBRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3OS2/c1-6-3-4-8(5-7(6)2)15-10(13)9(11(14)16)18-12(15)17/h3-5H,13H2,1-2H3,(H2,14,16).
What are the key properties of 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide?
4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide has a molecular weight of 279.39 g/mol, XLogP of 2.57, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 3432012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).