C19H19N3O4 — CID 3432119
2-(1-ethyl-2,4-dioxoquinazolin-3-yl)-N-(2-methoxyphenyl)acetamide (PubChem CID 3432119) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-(1-ethyl-2,4-dioxoquinazolin-3-yl)-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-(1-ethyl-2,4-dioxoquinazolin-3-yl)-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3432119 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-(1-ethyl-2,4-dioxoquinazolin-3-yl)-N-(2-methoxyphenyl)acetamide |
| SMILES | CCn1c(=O)n(CC(=O)Nc2ccccc2OC)c(=O)c2ccccc21 |
| InChI | InChI=1S/C19H19N3O4/c1-3-21-15-10-6-4-8-13(15)18(24)22(19(21)25)12-17(23)20-14-9-5-7-11-16(14)26-2/h4-11H,3,12H2,1-2H3,(H,20,23) |
| InChIKey | YKZFVJUSXASMPX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |