C27H36N4O2S2 — CID 3432199
5-[[2-(3,5-dimethylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-heptyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3432199) has the molecular formula C27H36N4O2S2 and a molecular weight of 512.75 g/mol. Its IUPAC name is 5-[[2-(3,5-dimethylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-heptyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-(3,5-dimethylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-heptyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3432199 |
| Molecular Formula | C27H36N4O2S2 |
| Molecular Weight | 512.75 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 5-[[2-(3,5-dimethylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-heptyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCN1C(=O)C(=Cc2c(N3CC(C)CC(C)C3)nc3c(C)cccn3c2=O)SC1=S |
| InChI | InChI=1S/C27H36N4O2S2/c1-5-6-7-8-9-12-31-26(33)22(35-27(31)34)15-21-24(29-16-18(2)14-19(3)17-29)28-23-20(4)11-10-13-30(23)25(21)32/h10-11,13,15,18-19H,5-9,12,14,16-17H2,1-4H3 |
| InChIKey | XMLPOWZYZSHASR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.75 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|