C30H20ClN3O2S — CID 3432264
2-(4-chlorophenyl)sulfonyl-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]prop-2-enenitrile (PubChem CID 3432264) has the molecular formula C30H20ClN3O2S and a molecular weight of 522.03 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]prop-2-enenitrile.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3432264 |
| Molecular Formula | C30H20ClN3O2S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-n2nc(-c3ccccc3)cc2-c2ccccc2)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H20ClN3O2S/c31-25-13-17-27(18-14-25)37(35,36)28(21-32)19-22-11-15-26(16-12-22)34-30(24-9-5-2-6-10-24)20-29(33-34)23-7-3-1-4-8-23/h1-20H |
| InChIKey | OXCSQKWZCUAQRB-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|