C17H16N6O2 — CID 3432411
2-N-methyl-5-nitro-2-N,4-N-diphenylpyrimidine-2,4,6-triamine (PubChem CID 3432411) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-N-methyl-5-nitro-2-N,4-N-diphenylpyrimidine-2,4,6-triamine.
| Compound Name | 2-N-methyl-5-nitro-2-N,4-N-diphenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 3432411 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-N-methyl-5-nitro-2-N,4-N-diphenylpyrimidine-2,4,6-triamine |
| SMILES | CN(c1ccccc1)c1nc(N)c([N+](=O)[O-])c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H16N6O2/c1-22(13-10-6-3-7-11-13)17-20-15(18)14(23(24)25)16(21-17)19-12-8-4-2-5-9-12/h2-11H,1H3,(H3,18,19,20,21) |
| InChIKey | CTDHCCWHWNBUIE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|