C6H7N3O4 — CID 3432545
N-(2,4,6-trioxo-1,3-diazinan-5-yl)acetamide (PubChem CID 3432545) has the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. Its IUPAC name is N-(2,4,6-trioxo-1,3-diazinan-5-yl)acetamide.
| Compound Name | N-(2,4,6-trioxo-1,3-diazinan-5-yl)acetamide |
|---|---|
| PubChem CID | 3432545 |
| Molecular Formula | C6H7N3O4 |
| Molecular Weight | 185.14 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | N-(2,4,6-trioxo-1,3-diazinan-5-yl)acetamide |
| SMILES | CC(=O)NC1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C6H7N3O4/c1-2(10)7-3-4(11)8-6(13)9-5(3)12/h3H,1H3,(H,7,10)(H2,8,9,11,12,13) |
| InChIKey | SSLSOYGVRPQMBB-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.14 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|