C22H23F8N3O7S2 — CID 3432643
bis(2,2,3,3-tetrafluoropropyl) 4-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]diazenyl]benzene-1,3-disulfonate (PubChem CID 3432643) has the molecular formula C22H23F8N3O7S2 and a molecular weight of 657.56 g/mol. Its IUPAC name is bis(2,2,3,3-tetrafluoropropyl) 4-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]diazenyl]benzene-1,3-disulfonate.
| Compound Name | bis(2,2,3,3-tetrafluoropropyl) 4-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]diazenyl]benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 3432643 |
| Molecular Formula | C22H23F8N3O7S2 |
| Molecular Weight | 657.56 g/mol |
| Exact Mass | 657.08 |
| IUPAC Name | bis(2,2,3,3-tetrafluoropropyl) 4-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]diazenyl]benzene-1,3-disulfonate |
| SMILES | CCN(CCO)c1ccc(/N=N/c2ccc(S(=O)(=O)OCC(F)(F)C(F)F)cc2S(=O)(=O)OCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C22H23F8N3O7S2/c1-2-33(9-10-34)15-5-3-14(4-6-15)31-32-17-8-7-16(41(35,36)39-12-21(27,28)19(23)24)11-18(17)42(37,38)40-13-22(29,30)20(25)26/h3-8,11,19-20,34H,2,9-10,12-13H2,1H3/b32-31+ |
| InChIKey | OLHLSFKOMGPQDN-QNEJGDQOSA-N |
| XLogP | 5.13 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|