About 2-acetyloxybenzoate
2-acetyloxybenzoate (PubChem CID 3434975) has the molecular formula C9H7O4-
and a molecular weight of 179.15 g/mol. Its IUPAC name is 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | 2-acetyloxybenzoate |
| PubChem CID | 3434975 |
| Molecular Formula | C9H7O4- |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)/p-1 |
| InChIKey | BSYNRYMUTXBXSQ-UHFFFAOYSA-M |
| XLogP | -0.02 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxybenzoate?
The IUPAC name of 2-acetyloxybenzoate (CID 3434975) is 2-acetyloxybenzoate.
What is the SMILES notation for 2-acetyloxybenzoate?
The canonical SMILES for 2-acetyloxybenzoate is CC(=O)Oc1ccccc1C(=O)[O-].
What is the InChIKey of 2-acetyloxybenzoate?
The InChIKey is BSYNRYMUTXBXSQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)/p-1.
What are the key properties of 2-acetyloxybenzoate?
2-acetyloxybenzoate has a molecular weight of 179.15 g/mol, XLogP of -0.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxybenzoate is sourced from PubChem (CID 3434975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).