C15H14N4S — CID 3435441
6-methyl-4-pyridin-4-yl-2-sulfanylidene-1,5,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile (PubChem CID 3435441) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is 6-methyl-4-pyridin-4-yl-2-sulfanylidene-1,5,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile.
| Compound Name | 6-methyl-4-pyridin-4-yl-2-sulfanylidene-1,5,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3435441 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 6-methyl-4-pyridin-4-yl-2-sulfanylidene-1,5,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile |
| SMILES | CN1CCc2[nH]c(=S)c(C#N)c(-c3ccncc3)c2C1 |
| InChI | InChI=1S/C15H14N4S/c1-19-7-4-13-12(9-19)14(10-2-5-17-6-3-10)11(8-16)15(20)18-13/h2-3,5-6H,4,7,9H2,1H3,(H,18,20) |
| InChIKey | VFZLGHXFDOXUIO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|