C24H26NOP — CID 3435465
5-diphenylphosphoryl-1,2,3,3-tetramethyl-2H-indole (PubChem CID 3435465) has the molecular formula C24H26NOP and a molecular weight of 375.45 g/mol. Its IUPAC name is 5-diphenylphosphoryl-1,2,3,3-tetramethyl-2H-indole.
| Compound Name | 5-diphenylphosphoryl-1,2,3,3-tetramethyl-2H-indole |
|---|---|
| PubChem CID | 3435465 |
| Molecular Formula | C24H26NOP |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 5-diphenylphosphoryl-1,2,3,3-tetramethyl-2H-indole |
| SMILES | CC1N(C)c2ccc(P(=O)(c3ccccc3)c3ccccc3)cc2C1(C)C |
| InChI | InChI=1S/C24H26NOP/c1-18-24(2,3)22-17-21(15-16-23(22)25(18)4)27(26,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-18H,1-4H3 |
| InChIKey | IDKJYURVTPXLSH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|